Cambridge Past Paper Questions
Browse 23,507questions from 25 years of O-Level & A-Level exams. Click any question to practice.
Which species contains a different number of electrons from the other three?
Which factor causes helium to have a higher first ionisation energy than hydrogen?
A 0.216g sample of aluminium carbide reacts with an excess of water to produce methane gas. This is the only carbon-containing product formed in th...
A reaction between two gases takes place on the surface of the catalytic converter of a petrol-engined car. In this reaction, four reactant molecul...
An ion contains 1 nitrogen atom and 2 hydrogen atoms. It has an H–N-H bond angle of approximately 105°. Which row is correct?
Why does ICl have a higher boiling point than Br2?
In this question you may assume that nitrogen behaves as an ideal gas. One atmosphere pressure = 101 kPa. Which volume does 1.0 g of nitrogen occup...
Which statement about the properties associated with the different types of bonding involved is correct?
For which reaction is the enthalpy change an enthalpy change of formation?
Two standard enthalpy change of formation values are given. ΔΗ [VCl2] = −452 kJ mol⁻¹ ∆Η [VC13] = −573 kJ mol⁻¹ What is the enthalpy change for the...
Equations for some reactions of hydrogen peroxide are given. 1 2Fe²⁺ + H2O2 + 2H⁺ → 2Fe³⁺ + 2H2O 2 2MnO4⁻ + 5H2O2 + 6H⁺ → 2Mn²⁺ + 8H2O + 5O2 3 2Fe³...
The equation for the reaction of aqueous thiosulfate ions, S2O3²⁻, and aqueous dioxo-vanadium ions, VO2⁺, is shown. 2S2O3²⁻ + XVO2⁺ + yH⁺ → S4O6²⁻ ...
When some solid Ca5(PO4)3OH is added to a beaker of water, an equilibrium is set up. Ca5(PO4)3OH(s) ⇌ 5Ca²⁺(aq) + 3PO4³⁻(aq) + OH⁻(aq) Which compou...
Gaseous hydrogen and gaseous iodine react to form gaseous hydrogen iodide. H2(g) + I2(g) ⇌ 2HI(g) In an experiment, 2.0 mol of hydrogen and 2.0 mol...
Why does the rate of a gaseous reaction increase when the pressure is increased at a constant temperature?
The Boltzmann distribution for a mixture of gases capable of reaction is shown. The two curves represent the mixture of gases at 25°C and at 35°C. ...
Sodium and sulfur are burned separately in oxygen. Each reaction has a distinctive coloured flame. Which row is correct?
X and Y are elements in Period 3 of the Periodic Table. Y has a greater atomic number than X. The stable ion formed by Y has a greater radius than ...
X is a Group 2 element in either Period 3 or Period 5. X(OH)2 is less soluble in water than Ca(OH)2. When X(NO3)2 is heated, it decomposes. Which r...
Which statement comparing magnesium and barium, or their compounds, is correct?
The colours of the silver halides AgCl, AgBr and AgI differ. The solubilities of these halides in aqueous ammonia also differ. Which row is correct?
The name 'chlorate' is used for an anion consisting of chlorine and oxygen only. In a molecule of ICl, the iodine atom has oxidation number x and t...
The diagram shows the structural formula of a hydrocarbon molecule Q. [Figure showing structural formula of molecule Q] How many of the carbon atom...
Compound X is found in cell walls of some bacteria. Its structural formula is shown. compound X CH3(CH2)17CH=CH(CH2)17CH(OH)CH(CH3)CO2H How many st...
Structural isomerism only should be considered when answering this question. How many straight-chain isomers are there with molecular formula C4H8Cl2?
What is true of every nucleophile?
The diagram shows a synthetic route to produce 1-methylcyclohexanol. [Figure showing reaction scheme from methylcyclohexane to product X then to 1-...
X and Y are the reagents required to convert 1-bromopropane into butanoic acid. [Figure showing reaction scheme from 1-bromopropane to an intermedi...
The table shows three sets of reagents and reaction conditions. Which sets of reagents and conditions can be used to produce 2-chloro-2-methylpropa...
The compound 'leaf alcohol' is partly responsible for the smell of new-mown grass. leaf alcohol CH3CH2CH=CHCH2CH2OH What will be formed when ‘leaf ...
Compound X: • does not react with Tollens' reagent • forms a yellow precipitate with alkaline I2(aq) • does not react with sodium. What could be th...
Which compound can undergo nucleophilic addition?
C2H5COOCH3 is reacted with aqueous acid. The products from this reaction are reacted with LiAlH4 to form two molecules Y and Z. What are the identi...
A sample of propanoic acid of mass 3.70 g reacts with an excess of magnesium. A second sample of propanoic acid of mass 3.70 g reacts with an exces...
Which statement about H2C=C(CH3)CH2CO2CH3 is correct?
Vitamin C has the structure shown. [Figure showing the structure of Vitamin C] The mass spectrum of vitamin C has a molecular ion peak with an m/e ...
Cobalt, rhodium and iridium are metals in the same group of the Periodic Table.
Chlorine is one of the elements in Group 17 of the Periodic Table.
The Group 14 elements show a change from non-metallic to metallic character down the group. (a) Table 3.1 shows some properties of two Group 14 ele...
Propanone, CH₃COCH₃, is an important organic reagent. [Figure 4.1] shows some reactions of propanone and its derivatives. propanone O // H₃...
Vanadium, niobium and tantalum are metals in the same group of the Periodic Table.
Oxygen is a Group 16 element.
Nitrogen and phosphorus are elements in Group 15 of the Periodic Table.
Bromoalkanes are used widely in industry, although there is increasing concern about their environmental impact. Fig. 4.1 shows a reaction scheme i...
The Group 14 elements show a change from non-metallic to metallic character down the group.
2 Acids react with carbonates to produce carbon dioxide gas. Na2CO3(s) + H2SO4(aq) → Na2SO4(aq) + CO2(g) + H2O(l) This reaction can be used to dete...
When a metal carbonate reacts with a suitable acid, carbon dioxide is produced. You will determine the relative formula mass, M₁, of a metal carbon...
Disodium phosphate, (Na+)2(HPO42¯), reacts with an acid to form monosodium phosphate, Na+(H2PO4¯).
A and B react together to give product AB. A + B → AB When the concentrations of A and B are both 0.0100 moldm¯³, the rate of formation of AB is 7....